C11H6F4N4O — CID 114387361
4-fluoro-N-(1,2,4-triazin-3-yl)-3-(trifluoromethyl)benzamide (PubChem CID 114387361) has the molecular formula C11H6F4N4O and a molecular weight of 286.19 g/mol. Its IUPAC name is 4-fluoro-N-(1,2,4-triazin-3-yl)-3-(trifluoromethyl)benzamide.
| Compound Name | 4-fluoro-N-(1,2,4-triazin-3-yl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 114387361 |
| Molecular Formula | C11H6F4N4O |
| Molecular Weight | 286.19 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 4-fluoro-N-(1,2,4-triazin-3-yl)-3-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1nccnn1)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H6F4N4O/c12-8-2-1-6(5-7(8)11(13,14)15)9(20)18-10-16-3-4-17-19-10/h1-5H,(H,16,18,19,20) |
| InChIKey | GRIYNHSATLKBGB-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.19 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |