About 4-fluoro-N-(1,2,4-triazin-3-yl)-3-(trifluoromethyl)benzamide
4-fluoro-N-(1,2,4-triazin-3-yl)-3-(trifluoromethyl)benzamide (PubChem CID 114387361) has the molecular formula C11H6F4N4O
and a molecular weight of 286.19 g/mol. Its IUPAC name is 4-fluoro-N-(1,2,4-triazin-3-yl)-3-(trifluoromethyl)benzamide.
Molecular Properties
| Compound Name | 4-fluoro-N-(1,2,4-triazin-3-yl)-3-(trifluoromethyl)benzamide |
| PubChem CID | 114387361 |
| Molecular Formula | C11H6F4N4O |
| Molecular Weight | 286.19 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 4-fluoro-N-(1,2,4-triazin-3-yl)-3-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1nccnn1)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H6F4N4O/c12-8-2-1-6(5-7(8)11(13,14)15)9(20)18-10-16-3-4-17-19-10/h1-5H,(H,16,18,19,20) |
| InChIKey | GRIYNHSATLKBGB-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.19 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-fluoro-N-(1,2,4-triazin-3-yl)-3-(trifluoromethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-N-(1,2,4-triazin-3-yl)-3-(trifluoromethyl)benzamide?
The IUPAC name of 4-fluoro-N-(1,2,4-triazin-3-yl)-3-(trifluoromethyl)benzamide (CID 114387361) is 4-fluoro-N-(1,2,4-triazin-3-yl)-3-(trifluoromethyl)benzamide.
What is the SMILES notation for 4-fluoro-N-(1,2,4-triazin-3-yl)-3-(trifluoromethyl)benzamide?
The canonical SMILES for 4-fluoro-N-(1,2,4-triazin-3-yl)-3-(trifluoromethyl)benzamide is O=C(Nc1nccnn1)c1ccc(F)c(C(F)(F)F)c1.
What is the InChIKey of 4-fluoro-N-(1,2,4-triazin-3-yl)-3-(trifluoromethyl)benzamide?
The InChIKey is GRIYNHSATLKBGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6F4N4O/c12-8-2-1-6(5-7(8)11(13,14)15)9(20)18-10-16-3-4-17-19-10/h1-5H,(H,16,18,19,20).
What are the key properties of 4-fluoro-N-(1,2,4-triazin-3-yl)-3-(trifluoromethyl)benzamide?
4-fluoro-N-(1,2,4-triazin-3-yl)-3-(trifluoromethyl)benzamide has a molecular weight of 286.19 g/mol, XLogP of 2.28, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-N-(1,2,4-triazin-3-yl)-3-(trifluoromethyl)benzamide is sourced from PubChem (CID 114387361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).