C11H6BrF3N4O — CID 107332970
4-bromo-N-(1,2,4-triazin-3-yl)-2-(trifluoromethyl)benzamide (PubChem CID 107332970) has the molecular formula C11H6BrF3N4O and a molecular weight of 347.09 g/mol. Its IUPAC name is 4-bromo-N-(1,2,4-triazin-3-yl)-2-(trifluoromethyl)benzamide.
| Compound Name | 4-bromo-N-(1,2,4-triazin-3-yl)-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 107332970 |
| Molecular Formula | C11H6BrF3N4O |
| Molecular Weight | 347.09 g/mol |
| Exact Mass | 345.97 |
| IUPAC Name | 4-bromo-N-(1,2,4-triazin-3-yl)-2-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1nccnn1)c1ccc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C11H6BrF3N4O/c12-6-1-2-7(8(5-6)11(13,14)15)9(20)18-10-16-3-4-17-19-10/h1-5H,(H,16,18,19,20) |
| InChIKey | WXEKLTPZIJWLES-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.09 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |