C13H14ClN5O — CID 114387350
2-tert-butyl-6-chloro-N-(1,2,4-triazin-3-yl)pyridine-4-carboxamide (PubChem CID 114387350) has the molecular formula C13H14ClN5O and a molecular weight of 291.74 g/mol. Its IUPAC name is 2-tert-butyl-6-chloro-N-(1,2,4-triazin-3-yl)pyridine-4-carboxamide.
| Compound Name | 2-tert-butyl-6-chloro-N-(1,2,4-triazin-3-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114387350 |
| Molecular Formula | C13H14ClN5O |
| Molecular Weight | 291.74 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 2-tert-butyl-6-chloro-N-(1,2,4-triazin-3-yl)pyridine-4-carboxamide |
| SMILES | CC(C)(C)c1cc(C(=O)Nc2nccnn2)cc(Cl)n1 |
| InChI | InChI=1S/C13H14ClN5O/c1-13(2,3)9-6-8(7-10(14)17-9)11(20)18-12-15-4-5-16-19-12/h4-7H,1-3H3,(H,15,18,19,20) |
| InChIKey | HKWBHNQVSWZIRB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.74 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|