C8H5BrN4O2 — CID 130636960
5-bromo-N-(1,2,4-triazin-3-yl)furan-3-carboxamide (PubChem CID 130636960) has the molecular formula C8H5BrN4O2 and a molecular weight of 269.06 g/mol. Its IUPAC name is 5-bromo-N-(1,2,4-triazin-3-yl)furan-3-carboxamide.
| Compound Name | 5-bromo-N-(1,2,4-triazin-3-yl)furan-3-carboxamide |
|---|---|
| PubChem CID | 130636960 |
| Molecular Formula | C8H5BrN4O2 |
| Molecular Weight | 269.06 g/mol |
| Exact Mass | 267.96 |
| IUPAC Name | 5-bromo-N-(1,2,4-triazin-3-yl)furan-3-carboxamide |
| SMILES | O=C(Nc1nccnn1)c1coc(Br)c1 |
| InChI | InChI=1S/C8H5BrN4O2/c9-6-3-5(4-15-6)7(14)12-8-10-1-2-11-13-8/h1-4H,(H,10,12,13,14) |
| InChIKey | JRLGQIRCZCSNMQ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.06 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |