C15H21ClN2O — CID 113379890
2-tert-butyl-6-chloro-N-(2,2-dimethylcyclopropyl)pyridine-4-carboxamide (PubChem CID 113379890) has the molecular formula C15H21ClN2O and a molecular weight of 280.80 g/mol. Its IUPAC name is 2-tert-butyl-6-chloro-N-(2,2-dimethylcyclopropyl)pyridine-4-carboxamide.
| Compound Name | 2-tert-butyl-6-chloro-N-(2,2-dimethylcyclopropyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 113379890 |
| Molecular Formula | C15H21ClN2O |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 2-tert-butyl-6-chloro-N-(2,2-dimethylcyclopropyl)pyridine-4-carboxamide |
| SMILES | CC(C)(C)c1cc(C(=O)NC2CC2(C)C)cc(Cl)n1 |
| InChI | InChI=1S/C15H21ClN2O/c1-14(2,3)10-6-9(7-12(16)17-10)13(19)18-11-8-15(11,4)5/h6-7,11H,8H2,1-5H3,(H,18,19) |
| InChIKey | WDKDXTLOJFSLQX-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|