C14H14Cl2N4O — CID 116794886
2-tert-butyl-6-chloro-N-(2-chloropyrimidin-4-yl)pyridine-4-carboxamide (PubChem CID 116794886) has the molecular formula C14H14Cl2N4O and a molecular weight of 325.20 g/mol. Its IUPAC name is 2-tert-butyl-6-chloro-N-(2-chloropyrimidin-4-yl)pyridine-4-carboxamide.
| Compound Name | 2-tert-butyl-6-chloro-N-(2-chloropyrimidin-4-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 116794886 |
| Molecular Formula | C14H14Cl2N4O |
| Molecular Weight | 325.20 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 2-tert-butyl-6-chloro-N-(2-chloropyrimidin-4-yl)pyridine-4-carboxamide |
| SMILES | CC(C)(C)c1cc(C(=O)Nc2ccnc(Cl)n2)cc(Cl)n1 |
| InChI | InChI=1S/C14H14Cl2N4O/c1-14(2,3)9-6-8(7-10(15)18-9)12(21)19-11-4-5-17-13(16)20-11/h4-7H,1-3H3,(H,17,19,20,21) |
| InChIKey | XLKCPKKXFCNJKV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.20 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|