C12H15N7O — CID 114389598
2-hydrazinyl-6-propan-2-yl-N-(1,2,4-triazin-3-yl)pyridine-4-carboxamide (PubChem CID 114389598) has the molecular formula C12H15N7O and a molecular weight of 273.30 g/mol. Its IUPAC name is 2-hydrazinyl-6-propan-2-yl-N-(1,2,4-triazin-3-yl)pyridine-4-carboxamide.
| Compound Name | 2-hydrazinyl-6-propan-2-yl-N-(1,2,4-triazin-3-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114389598 |
| Molecular Formula | C12H15N7O |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 2-hydrazinyl-6-propan-2-yl-N-(1,2,4-triazin-3-yl)pyridine-4-carboxamide |
| SMILES | CC(C)c1cc(C(=O)Nc2nccnn2)cc(NN)n1 |
| InChI | InChI=1S/C12H15N7O/c1-7(2)9-5-8(6-10(16-9)18-13)11(20)17-12-14-3-4-15-19-12/h3-7H,13H2,1-2H3,(H,16,18)(H,14,17,19,20) |
| InChIKey | ZXGQHXFROAJRHK-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 118.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|