C19H23NO6S — CID 120821824
5-[[3-(tert-butylsulfonylmethyl)phenyl]carbamoyl]-2-ethylfuran-3-carboxylic acid (PubChem CID 120821824) has the molecular formula C19H23NO6S and a molecular weight of 393.46 g/mol. Its IUPAC name is 5-[[3-(tert-butylsulfonylmethyl)phenyl]carbamoyl]-2-ethylfuran-3-carboxylic acid.
| Compound Name | 5-[[3-(tert-butylsulfonylmethyl)phenyl]carbamoyl]-2-ethylfuran-3-carboxylic acid |
|---|---|
| PubChem CID | 120821824 |
| Molecular Formula | C19H23NO6S |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 5-[[3-(tert-butylsulfonylmethyl)phenyl]carbamoyl]-2-ethylfuran-3-carboxylic acid |
| SMILES | CCc1oc(C(=O)Nc2cccc(CS(=O)(=O)C(C)(C)C)c2)cc1C(=O)O |
| InChI | InChI=1S/C19H23NO6S/c1-5-15-14(18(22)23)10-16(26-15)17(21)20-13-8-6-7-12(9-13)11-27(24,25)19(2,3)4/h6-10H,5,11H2,1-4H3,(H,20,21)(H,22,23) |
| InChIKey | ITEUPYSLMNZSJY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |