C21H27NO3S2 — CID 86940762
N-[3-(tert-butylsulfonylmethyl)phenyl]-2-methyl-3-phenylsulfanylpropanamide (PubChem CID 86940762) has the molecular formula C21H27NO3S2 and a molecular weight of 405.59 g/mol. Its IUPAC name is N-[3-(tert-butylsulfonylmethyl)phenyl]-2-methyl-3-phenylsulfanylpropanamide.
| Compound Name | N-[3-(tert-butylsulfonylmethyl)phenyl]-2-methyl-3-phenylsulfanylpropanamide |
|---|---|
| PubChem CID | 86940762 |
| Molecular Formula | C21H27NO3S2 |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | N-[3-(tert-butylsulfonylmethyl)phenyl]-2-methyl-3-phenylsulfanylpropanamide |
| SMILES | CC(CSc1ccccc1)C(=O)Nc1cccc(CS(=O)(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C21H27NO3S2/c1-16(14-26-19-11-6-5-7-12-19)20(23)22-18-10-8-9-17(13-18)15-27(24,25)21(2,3)4/h5-13,16H,14-15H2,1-4H3,(H,22,23) |
| InChIKey | YNKYBYCAQIJSQT-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |