C12H9BrN2O4 — CID 113281025
2-bromo-5-[(4-methyl-1,3-oxazole-5-carbonyl)amino]benzoic acid (PubChem CID 113281025) has the molecular formula C12H9BrN2O4 and a molecular weight of 325.12 g/mol. Its IUPAC name is 2-bromo-5-[(4-methyl-1,3-oxazole-5-carbonyl)amino]benzoic acid.
| Compound Name | 2-bromo-5-[(4-methyl-1,3-oxazole-5-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 113281025 |
| Molecular Formula | C12H9BrN2O4 |
| Molecular Weight | 325.12 g/mol |
| Exact Mass | 323.97 |
| IUPAC Name | 2-bromo-5-[(4-methyl-1,3-oxazole-5-carbonyl)amino]benzoic acid |
| SMILES | Cc1ncoc1C(=O)Nc1ccc(Br)c(C(=O)O)c1 |
| InChI | InChI=1S/C12H9BrN2O4/c1-6-10(19-5-14-6)11(16)15-7-2-3-9(13)8(4-7)12(17)18/h2-5H,1H3,(H,15,16)(H,17,18) |
| InChIKey | CGDXBJYULKZCLI-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.12 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |