C11H8BrN3O3S — CID 54933005
4-bromo-2-[(4-methylthiadiazole-5-carbonyl)amino]benzoic acid (PubChem CID 54933005) has the molecular formula C11H8BrN3O3S and a molecular weight of 342.17 g/mol. Its IUPAC name is 4-bromo-2-[(4-methylthiadiazole-5-carbonyl)amino]benzoic acid.
| Compound Name | 4-bromo-2-[(4-methylthiadiazole-5-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 54933005 |
| Molecular Formula | C11H8BrN3O3S |
| Molecular Weight | 342.17 g/mol |
| Exact Mass | 340.95 |
| IUPAC Name | 4-bromo-2-[(4-methylthiadiazole-5-carbonyl)amino]benzoic acid |
| SMILES | Cc1nnsc1C(=O)Nc1cc(Br)ccc1C(=O)O |
| InChI | InChI=1S/C11H8BrN3O3S/c1-5-9(19-15-14-5)10(16)13-8-4-6(12)2-3-7(8)11(17)18/h2-4H,1H3,(H,13,16)(H,17,18) |
| InChIKey | DLIOYXUPUYNVEU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.17 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |