C12H9BrN2O3S — CID 114030937
4-bromo-2-[(2-methyl-1,3-thiazole-5-carbonyl)amino]benzoic acid (PubChem CID 114030937) has the molecular formula C12H9BrN2O3S and a molecular weight of 341.19 g/mol. Its IUPAC name is 4-bromo-2-[(2-methyl-1,3-thiazole-5-carbonyl)amino]benzoic acid.
| Compound Name | 4-bromo-2-[(2-methyl-1,3-thiazole-5-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 114030937 |
| Molecular Formula | C12H9BrN2O3S |
| Molecular Weight | 341.19 g/mol |
| Exact Mass | 339.95 |
| IUPAC Name | 4-bromo-2-[(2-methyl-1,3-thiazole-5-carbonyl)amino]benzoic acid |
| SMILES | Cc1ncc(C(=O)Nc2cc(Br)ccc2C(=O)O)s1 |
| InChI | InChI=1S/C12H9BrN2O3S/c1-6-14-5-10(19-6)11(16)15-9-4-7(13)2-3-8(9)12(17)18/h2-5H,1H3,(H,15,16)(H,17,18) |
| InChIKey | HIASBCILNGRRJA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.19 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |