C12H11N3O2S — CID 7576719
N-(2-acetylphenyl)-4-methylthiadiazole-5-carboxamide (PubChem CID 7576719) has the molecular formula C12H11N3O2S and a molecular weight of 261.31 g/mol. Its IUPAC name is N-(2-acetylphenyl)-4-methylthiadiazole-5-carboxamide.
| Compound Name | N-(2-acetylphenyl)-4-methylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 7576719 |
| Molecular Formula | C12H11N3O2S |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | N-(2-acetylphenyl)-4-methylthiadiazole-5-carboxamide |
| SMILES | CC(=O)c1ccccc1NC(=O)c1snnc1C |
| InChI | InChI=1S/C12H11N3O2S/c1-7-11(18-15-14-7)12(17)13-10-6-4-3-5-9(10)8(2)16/h3-6H,1-2H3,(H,13,17) |
| InChIKey | GLHUHWMVPLPDIS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |