C9H3BrCl3N3OS — CID 1498983
5-bromo-N-(2,4,6-trichlorophenyl)thiadiazole-4-carboxamide (PubChem CID 1498983) has the molecular formula C9H3BrCl3N3OS and a molecular weight of 387.47 g/mol. Its IUPAC name is 5-bromo-N-(2,4,6-trichlorophenyl)thiadiazole-4-carboxamide.
| Compound Name | 5-bromo-N-(2,4,6-trichlorophenyl)thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 1498983 |
| Molecular Formula | C9H3BrCl3N3OS |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 384.82 |
| IUPAC Name | 5-bromo-N-(2,4,6-trichlorophenyl)thiadiazole-4-carboxamide |
| SMILES | O=C(Nc1c(Cl)cc(Cl)cc1Cl)c1nnsc1Br |
| InChI | InChI=1S/C9H3BrCl3N3OS/c10-8-7(15-16-18-8)9(17)14-6-4(12)1-3(11)2-5(6)13/h1-2H,(H,14,17) |
| InChIKey | HVXNHDOPUCVEDK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |