C20H23BrN2O4 — CID 60586585
2-methoxyethyl N-[3-[[2-(4-bromophenyl)-2-methylpropanoyl]amino]phenyl]carbamate (PubChem CID 60586585) has the molecular formula C20H23BrN2O4 and a molecular weight of 435.32 g/mol. Its IUPAC name is 2-methoxyethyl N-[3-[[2-(4-bromophenyl)-2-methylpropanoyl]amino]phenyl]carbamate.
| Compound Name | 2-methoxyethyl N-[3-[[2-(4-bromophenyl)-2-methylpropanoyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 60586585 |
| Molecular Formula | C20H23BrN2O4 |
| Molecular Weight | 435.32 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | 2-methoxyethyl N-[3-[[2-(4-bromophenyl)-2-methylpropanoyl]amino]phenyl]carbamate |
| SMILES | COCCOC(=O)Nc1cccc(NC(=O)C(C)(C)c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C20H23BrN2O4/c1-20(2,14-7-9-15(21)10-8-14)18(24)22-16-5-4-6-17(13-16)23-19(25)27-12-11-26-3/h4-10,13H,11-12H2,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | GUSZQDXJTNFVNN-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.32 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|