C17H19N3O6 — CID 47934073
2-methoxyethyl N-[3-[[2-(furan-3-carbonylamino)acetyl]amino]phenyl]carbamate (PubChem CID 47934073) has the molecular formula C17H19N3O6 and a molecular weight of 361.35 g/mol. Its IUPAC name is 2-methoxyethyl N-[3-[[2-(furan-3-carbonylamino)acetyl]amino]phenyl]carbamate.
| Compound Name | 2-methoxyethyl N-[3-[[2-(furan-3-carbonylamino)acetyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 47934073 |
| Molecular Formula | C17H19N3O6 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 2-methoxyethyl N-[3-[[2-(furan-3-carbonylamino)acetyl]amino]phenyl]carbamate |
| SMILES | COCCOC(=O)Nc1cccc(NC(=O)CNC(=O)c2ccoc2)c1 |
| InChI | InChI=1S/C17H19N3O6/c1-24-7-8-26-17(23)20-14-4-2-3-13(9-14)19-15(21)10-18-16(22)12-5-6-25-11-12/h2-6,9,11H,7-8,10H2,1H3,(H,18,22)(H,19,21)(H,20,23) |
| InChIKey | PIEUXLMFOYAIOR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 118.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|