C12H16N4O4 — CID 60927446
methyl N-[3-[[2-[(2-aminoacetyl)amino]acetyl]amino]phenyl]carbamate (PubChem CID 60927446) has the molecular formula C12H16N4O4 and a molecular weight of 280.28 g/mol. Its IUPAC name is methyl N-[3-[[2-[(2-aminoacetyl)amino]acetyl]amino]phenyl]carbamate.
| Compound Name | methyl N-[3-[[2-[(2-aminoacetyl)amino]acetyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 60927446 |
| Molecular Formula | C12H16N4O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | methyl N-[3-[[2-[(2-aminoacetyl)amino]acetyl]amino]phenyl]carbamate |
| SMILES | COC(=O)Nc1cccc(NC(=O)CNC(=O)CN)c1 |
| InChI | InChI=1S/C12H16N4O4/c1-20-12(19)16-9-4-2-3-8(5-9)15-11(18)7-14-10(17)6-13/h2-5H,6-7,13H2,1H3,(H,14,17)(H,15,18)(H,16,19) |
| InChIKey | ZMAXZVMEQLUTGI-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |