C15H20N2O5 — CID 56816642
5-[3-(methoxycarbonylamino)anilino]-3,3-dimethyl-5-oxopentanoic acid (PubChem CID 56816642) has the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. Its IUPAC name is 5-[3-(methoxycarbonylamino)anilino]-3,3-dimethyl-5-oxopentanoic acid.
| Compound Name | 5-[3-(methoxycarbonylamino)anilino]-3,3-dimethyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 56816642 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 5-[3-(methoxycarbonylamino)anilino]-3,3-dimethyl-5-oxopentanoic acid |
| SMILES | COC(=O)Nc1cccc(NC(=O)CC(C)(C)CC(=O)O)c1 |
| InChI | InChI=1S/C15H20N2O5/c1-15(2,9-13(19)20)8-12(18)16-10-5-4-6-11(7-10)17-14(21)22-3/h4-7H,8-9H2,1-3H3,(H,16,18)(H,17,21)(H,19,20) |
| InChIKey | NUGLOLOHZGVRHF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |