C20H23NO4S — CID 119133863
5-[3-(benzenesulfinylmethyl)anilino]-3,3-dimethyl-5-oxopentanoic acid (PubChem CID 119133863) has the molecular formula C20H23NO4S and a molecular weight of 373.47 g/mol. Its IUPAC name is 5-[3-(benzenesulfinylmethyl)anilino]-3,3-dimethyl-5-oxopentanoic acid.
| Compound Name | 5-[3-(benzenesulfinylmethyl)anilino]-3,3-dimethyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 119133863 |
| Molecular Formula | C20H23NO4S |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 5-[3-(benzenesulfinylmethyl)anilino]-3,3-dimethyl-5-oxopentanoic acid |
| SMILES | CC(C)(CC(=O)O)CC(=O)Nc1cccc(CS(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C20H23NO4S/c1-20(2,13-19(23)24)12-18(22)21-16-8-6-7-15(11-16)14-26(25)17-9-4-3-5-10-17/h3-11H,12-14H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | CSMIQBUVHUZWDC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |