C16H21N5O3 — CID 119137389
5-[3-(1-ethyltetrazol-5-yl)anilino]-3,3-dimethyl-5-oxopentanoic acid (PubChem CID 119137389) has the molecular formula C16H21N5O3 and a molecular weight of 331.38 g/mol. Its IUPAC name is 5-[3-(1-ethyltetrazol-5-yl)anilino]-3,3-dimethyl-5-oxopentanoic acid.
| Compound Name | 5-[3-(1-ethyltetrazol-5-yl)anilino]-3,3-dimethyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 119137389 |
| Molecular Formula | C16H21N5O3 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 5-[3-(1-ethyltetrazol-5-yl)anilino]-3,3-dimethyl-5-oxopentanoic acid |
| SMILES | CCn1nnnc1-c1cccc(NC(=O)CC(C)(C)CC(=O)O)c1 |
| InChI | InChI=1S/C16H21N5O3/c1-4-21-15(18-19-20-21)11-6-5-7-12(8-11)17-13(22)9-16(2,3)10-14(23)24/h5-8H,4,9-10H2,1-3H3,(H,17,22)(H,23,24) |
| InChIKey | VICDOVBNJUDPOW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |