C16H23ClN6O2 — CID 119795061
N-[3-(1-ethyltetrazol-5-yl)phenyl]-4-methoxypiperidine-4-carboxamide;hydrochloride (PubChem CID 119795061) has the molecular formula C16H23ClN6O2 and a molecular weight of 366.85 g/mol. Its IUPAC name is N-[3-(1-ethyltetrazol-5-yl)phenyl]-4-methoxypiperidine-4-carboxamide;hydrochloride.
| Compound Name | N-[3-(1-ethyltetrazol-5-yl)phenyl]-4-methoxypiperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119795061 |
| Molecular Formula | C16H23ClN6O2 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | N-[3-(1-ethyltetrazol-5-yl)phenyl]-4-methoxypiperidine-4-carboxamide;hydrochloride |
| SMILES | CCn1nnnc1-c1cccc(NC(=O)C2(OC)CCNCC2)c1.Cl |
| InChI | InChI=1S/C16H22N6O2.ClH/c1-3-22-14(19-20-21-22)12-5-4-6-13(11-12)18-15(23)16(24-2)7-9-17-10-8-16;/h4-6,11,17H,3,7-10H2,1-2H3,(H,18,23);1H |
| InChIKey | BOHTUYBAANOSFF-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |