C16H19N3O3 — CID 119399848
4-methoxy-N-[3-(1,3-oxazol-5-yl)phenyl]piperidine-4-carboxamide (PubChem CID 119399848) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is 4-methoxy-N-[3-(1,3-oxazol-5-yl)phenyl]piperidine-4-carboxamide.
| Compound Name | 4-methoxy-N-[3-(1,3-oxazol-5-yl)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 119399848 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 4-methoxy-N-[3-(1,3-oxazol-5-yl)phenyl]piperidine-4-carboxamide |
| SMILES | COC1(C(=O)Nc2cccc(-c3cnco3)c2)CCNCC1 |
| InChI | InChI=1S/C16H19N3O3/c1-21-16(5-7-17-8-6-16)15(20)19-13-4-2-3-12(9-13)14-10-18-11-22-14/h2-4,9-11,17H,5-8H2,1H3,(H,19,20) |
| InChIKey | IGZZFSQRNDZCDX-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |