About 4-methoxy-N-[3-(1,3-thiazol-2-yl)phenyl]piperidine-4-carboxamide
4-methoxy-N-[3-(1,3-thiazol-2-yl)phenyl]piperidine-4-carboxamide (PubChem CID 119399884) has the molecular formula C16H19N3O2S
and a molecular weight of 317.41 g/mol. Its IUPAC name is 4-methoxy-N-[3-(1,3-thiazol-2-yl)phenyl]piperidine-4-carboxamide.
Molecular Properties
| Compound Name | 4-methoxy-N-[3-(1,3-thiazol-2-yl)phenyl]piperidine-4-carboxamide |
| PubChem CID | 119399884 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 4-methoxy-N-[3-(1,3-thiazol-2-yl)phenyl]piperidine-4-carboxamide |
| SMILES | COC1(C(=O)Nc2cccc(-c3nccs3)c2)CCNCC1 |
| InChI | InChI=1S/C16H19N3O2S/c1-21-16(5-7-17-8-6-16)15(20)19-13-4-2-3-12(11-13)14-18-9-10-22-14/h2-4,9-11,17H,5-8H2,1H3,(H,19,20) |
| InChIKey | XNKIPUJZRHBTRA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-methoxy-N-[3-(1,3-thiazol-2-yl)phenyl]piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-N-[3-(1,3-thiazol-2-yl)phenyl]piperidine-4-carboxamide?
The IUPAC name of 4-methoxy-N-[3-(1,3-thiazol-2-yl)phenyl]piperidine-4-carboxamide (CID 119399884) is 4-methoxy-N-[3-(1,3-thiazol-2-yl)phenyl]piperidine-4-carboxamide.
What is the SMILES notation for 4-methoxy-N-[3-(1,3-thiazol-2-yl)phenyl]piperidine-4-carboxamide?
The canonical SMILES for 4-methoxy-N-[3-(1,3-thiazol-2-yl)phenyl]piperidine-4-carboxamide is COC1(C(=O)Nc2cccc(-c3nccs3)c2)CCNCC1.
What is the InChIKey of 4-methoxy-N-[3-(1,3-thiazol-2-yl)phenyl]piperidine-4-carboxamide?
The InChIKey is XNKIPUJZRHBTRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O2S/c1-21-16(5-7-17-8-6-16)15(20)19-13-4-2-3-12(11-13)14-18-9-10-22-14/h2-4,9-11,17H,5-8H2,1H3,(H,19,20).
What are the key properties of 4-methoxy-N-[3-(1,3-thiazol-2-yl)phenyl]piperidine-4-carboxamide?
4-methoxy-N-[3-(1,3-thiazol-2-yl)phenyl]piperidine-4-carboxamide has a molecular weight of 317.41 g/mol, XLogP of 2.52, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-N-[3-(1,3-thiazol-2-yl)phenyl]piperidine-4-carboxamide is sourced from PubChem (CID 119399884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).