C17H25N3O4 — CID 119751959
4-methoxy-N-[3-(2-methoxypropanoylamino)phenyl]piperidine-4-carboxamide (PubChem CID 119751959) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is 4-methoxy-N-[3-(2-methoxypropanoylamino)phenyl]piperidine-4-carboxamide.
| Compound Name | 4-methoxy-N-[3-(2-methoxypropanoylamino)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 119751959 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 4-methoxy-N-[3-(2-methoxypropanoylamino)phenyl]piperidine-4-carboxamide |
| SMILES | COC(C)C(=O)Nc1cccc(NC(=O)C2(OC)CCNCC2)c1 |
| InChI | InChI=1S/C17H25N3O4/c1-12(23-2)15(21)19-13-5-4-6-14(11-13)20-16(22)17(24-3)7-9-18-10-8-17/h4-6,11-12,18H,7-10H2,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | SXSIVMFPXNQSMU-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |