C15H21ClN6O — CID 119795067
N-[3-(1-ethyltetrazol-5-yl)phenyl]-2-pyrrolidin-2-ylacetamide;hydrochloride (PubChem CID 119795067) has the molecular formula C15H21ClN6O and a molecular weight of 336.83 g/mol. Its IUPAC name is N-[3-(1-ethyltetrazol-5-yl)phenyl]-2-pyrrolidin-2-ylacetamide;hydrochloride.
| Compound Name | N-[3-(1-ethyltetrazol-5-yl)phenyl]-2-pyrrolidin-2-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119795067 |
| Molecular Formula | C15H21ClN6O |
| Molecular Weight | 336.83 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | N-[3-(1-ethyltetrazol-5-yl)phenyl]-2-pyrrolidin-2-ylacetamide;hydrochloride |
| SMILES | CCn1nnnc1-c1cccc(NC(=O)CC2CCCN2)c1.Cl |
| InChI | InChI=1S/C15H20N6O.ClH/c1-2-21-15(18-19-20-21)11-5-3-6-13(9-11)17-14(22)10-12-7-4-8-16-12;/h3,5-6,9,12,16H,2,4,7-8,10H2,1H3,(H,17,22);1H |
| InChIKey | KCAHALLENKMLQW-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.83 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |