C14H21ClN6O2 — CID 119795069
N-[3-(1-ethyltetrazol-5-yl)phenyl]-2-(2-methoxyethylamino)acetamide;hydrochloride (PubChem CID 119795069) has the molecular formula C14H21ClN6O2 and a molecular weight of 340.82 g/mol. Its IUPAC name is N-[3-(1-ethyltetrazol-5-yl)phenyl]-2-(2-methoxyethylamino)acetamide;hydrochloride.
| Compound Name | N-[3-(1-ethyltetrazol-5-yl)phenyl]-2-(2-methoxyethylamino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119795069 |
| Molecular Formula | C14H21ClN6O2 |
| Molecular Weight | 340.82 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | N-[3-(1-ethyltetrazol-5-yl)phenyl]-2-(2-methoxyethylamino)acetamide;hydrochloride |
| SMILES | CCn1nnnc1-c1cccc(NC(=O)CNCCOC)c1.Cl |
| InChI | InChI=1S/C14H20N6O2.ClH/c1-3-20-14(17-18-19-20)11-5-4-6-12(9-11)16-13(21)10-15-7-8-22-2;/h4-6,9,15H,3,7-8,10H2,1-2H3,(H,16,21);1H |
| InChIKey | MJUKIOXVYJHVQY-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.82 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|