C20H24N2O2S — CID 120633764
(2S,4S)-N-[3-(benzenesulfinylmethyl)phenyl]-2-methylpiperidine-4-carboxamide (PubChem CID 120633764) has the molecular formula C20H24N2O2S and a molecular weight of 356.49 g/mol. Its IUPAC name is (2S,4S)-N-[3-(benzenesulfinylmethyl)phenyl]-2-methylpiperidine-4-carboxamide.
| Compound Name | (2S,4S)-N-[3-(benzenesulfinylmethyl)phenyl]-2-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 120633764 |
| Molecular Formula | C20H24N2O2S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | (2S,4S)-N-[3-(benzenesulfinylmethyl)phenyl]-2-methylpiperidine-4-carboxamide |
| SMILES | C[C@H]1C[C@@H](C(=O)Nc2cccc(CS(=O)c3ccccc3)c2)CCN1 |
| InChI | InChI=1S/C20H24N2O2S/c1-15-12-17(10-11-21-15)20(23)22-18-7-5-6-16(13-18)14-25(24)19-8-3-2-4-9-19/h2-9,13,15,17,21H,10-12,14H2,1H3,(H,22,23)/t15-,17-,25?/m0/s1 |
| InChIKey | LSHXJTPQOSKENO-BEBGGYGKSA-N |
| XLogP | 3.32 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |