C23H20N2O2S2 — CID 86956473
N-[3-(benzenesulfinylmethyl)phenyl]-3-(4-cyanophenyl)sulfanylpropanamide (PubChem CID 86956473) has the molecular formula C23H20N2O2S2 and a molecular weight of 420.56 g/mol. Its IUPAC name is N-[3-(benzenesulfinylmethyl)phenyl]-3-(4-cyanophenyl)sulfanylpropanamide.
| Compound Name | N-[3-(benzenesulfinylmethyl)phenyl]-3-(4-cyanophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 86956473 |
| Molecular Formula | C23H20N2O2S2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | N-[3-(benzenesulfinylmethyl)phenyl]-3-(4-cyanophenyl)sulfanylpropanamide |
| SMILES | N#Cc1ccc(SCCC(=O)Nc2cccc(CS(=O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C23H20N2O2S2/c24-16-18-9-11-21(12-10-18)28-14-13-23(26)25-20-6-4-5-19(15-20)17-29(27)22-7-2-1-3-8-22/h1-12,15H,13-14,17H2,(H,25,26) |
| InChIKey | FMMFXZGJGFBRHK-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |