C12H15N3O4 — CID 61254044
methyl 3-[[2-[(2-aminoacetyl)amino]acetyl]amino]benzoate (PubChem CID 61254044) has the molecular formula C12H15N3O4 and a molecular weight of 265.27 g/mol. Its IUPAC name is methyl 3-[[2-[(2-aminoacetyl)amino]acetyl]amino]benzoate.
| Compound Name | methyl 3-[[2-[(2-aminoacetyl)amino]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 61254044 |
| Molecular Formula | C12H15N3O4 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | methyl 3-[[2-[(2-aminoacetyl)amino]acetyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)CNC(=O)CN)c1 |
| InChI | InChI=1S/C12H15N3O4/c1-19-12(18)8-3-2-4-9(5-8)15-11(17)7-14-10(16)6-13/h2-5H,6-7,13H2,1H3,(H,14,16)(H,15,17) |
| InChIKey | LWCMBTWFJJOMRU-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |