C13H14N2O3 — CID 71627760
methyl 3-[[2-(prop-2-ynylamino)acetyl]amino]benzoate (PubChem CID 71627760) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is methyl 3-[[2-(prop-2-ynylamino)acetyl]amino]benzoate.
| Compound Name | methyl 3-[[2-(prop-2-ynylamino)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 71627760 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | methyl 3-[[2-(prop-2-ynylamino)acetyl]amino]benzoate |
| SMILES | C#CCNCC(=O)Nc1cccc(C(=O)OC)c1 |
| InChI | InChI=1S/C13H14N2O3/c1-3-7-14-9-12(16)15-11-6-4-5-10(8-11)13(17)18-2/h1,4-6,8,14H,7,9H2,2H3,(H,15,16) |
| InChIKey | PETIWYYARHYCDE-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|