C15H15ClN2O5 — CID 46450348
N-[2-(5-chloro-2,4-dimethoxyanilino)-2-oxoethyl]furan-3-carboxamide (PubChem CID 46450348) has the molecular formula C15H15ClN2O5 and a molecular weight of 338.75 g/mol. Its IUPAC name is N-[2-(5-chloro-2,4-dimethoxyanilino)-2-oxoethyl]furan-3-carboxamide.
| Compound Name | N-[2-(5-chloro-2,4-dimethoxyanilino)-2-oxoethyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 46450348 |
| Molecular Formula | C15H15ClN2O5 |
| Molecular Weight | 338.75 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | N-[2-(5-chloro-2,4-dimethoxyanilino)-2-oxoethyl]furan-3-carboxamide |
| SMILES | COc1cc(OC)c(NC(=O)CNC(=O)c2ccoc2)cc1Cl |
| InChI | InChI=1S/C15H15ClN2O5/c1-21-12-6-13(22-2)11(5-10(12)16)18-14(19)7-17-15(20)9-3-4-23-8-9/h3-6,8H,7H2,1-2H3,(H,17,20)(H,18,19) |
| InChIKey | YFLKPPIRMLZGIT-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.75 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |