C20H19N3O5 — CID 38629741
N-[2-[4-methoxy-3-(pyridin-4-ylmethoxy)anilino]-2-oxoethyl]furan-3-carboxamide (PubChem CID 38629741) has the molecular formula C20H19N3O5 and a molecular weight of 381.39 g/mol. Its IUPAC name is N-[2-[4-methoxy-3-(pyridin-4-ylmethoxy)anilino]-2-oxoethyl]furan-3-carboxamide.
| Compound Name | N-[2-[4-methoxy-3-(pyridin-4-ylmethoxy)anilino]-2-oxoethyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 38629741 |
| Molecular Formula | C20H19N3O5 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | N-[2-[4-methoxy-3-(pyridin-4-ylmethoxy)anilino]-2-oxoethyl]furan-3-carboxamide |
| SMILES | COc1ccc(NC(=O)CNC(=O)c2ccoc2)cc1OCc1ccncc1 |
| InChI | InChI=1S/C20H19N3O5/c1-26-17-3-2-16(10-18(17)28-12-14-4-7-21-8-5-14)23-19(24)11-22-20(25)15-6-9-27-13-15/h2-10,13H,11-12H2,1H3,(H,22,25)(H,23,24) |
| InChIKey | HIXJEKHOMVJWKJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 102.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |