C23H23ClN2O3 — CID 24565249
2-(benzhydrylamino)-N-(5-chloro-2,4-dimethoxyphenyl)acetamide (PubChem CID 24565249) has the molecular formula C23H23ClN2O3 and a molecular weight of 410.90 g/mol. Its IUPAC name is 2-(benzhydrylamino)-N-(5-chloro-2,4-dimethoxyphenyl)acetamide.
| Compound Name | 2-(benzhydrylamino)-N-(5-chloro-2,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 24565249 |
| Molecular Formula | C23H23ClN2O3 |
| Molecular Weight | 410.90 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 2-(benzhydrylamino)-N-(5-chloro-2,4-dimethoxyphenyl)acetamide |
| SMILES | COc1cc(OC)c(NC(=O)CNC(c2ccccc2)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C23H23ClN2O3/c1-28-20-14-21(29-2)19(13-18(20)24)26-22(27)15-25-23(16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-14,23,25H,15H2,1-2H3,(H,26,27) |
| InChIKey | QVJRHISHKWEMHI-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.90 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |