C18H19ClN2O4 — CID 35678379
N-[2-(5-chloro-2,4-dimethoxyanilino)-2-oxoethyl]-N-methylbenzamide (PubChem CID 35678379) has the molecular formula C18H19ClN2O4 and a molecular weight of 362.81 g/mol. Its IUPAC name is N-[2-(5-chloro-2,4-dimethoxyanilino)-2-oxoethyl]-N-methylbenzamide.
| Compound Name | N-[2-(5-chloro-2,4-dimethoxyanilino)-2-oxoethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 35678379 |
| Molecular Formula | C18H19ClN2O4 |
| Molecular Weight | 362.81 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | N-[2-(5-chloro-2,4-dimethoxyanilino)-2-oxoethyl]-N-methylbenzamide |
| SMILES | COc1cc(OC)c(NC(=O)CN(C)C(=O)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C18H19ClN2O4/c1-21(18(23)12-7-5-4-6-8-12)11-17(22)20-14-9-13(19)15(24-2)10-16(14)25-3/h4-10H,11H2,1-3H3,(H,20,22) |
| InChIKey | IIKMXQIXCXBPPH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.81 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |