C12H15FN2O3 — CID 108943203
N'-(3-fluorophenyl)-N-(2-methoxyethyl)propanediamide (PubChem CID 108943203) has the molecular formula C12H15FN2O3 and a molecular weight of 254.26 g/mol. Its IUPAC name is N'-(3-fluorophenyl)-N-(2-methoxyethyl)propanediamide.
| Compound Name | N'-(3-fluorophenyl)-N-(2-methoxyethyl)propanediamide |
|---|---|
| PubChem CID | 108943203 |
| Molecular Formula | C12H15FN2O3 |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | N'-(3-fluorophenyl)-N-(2-methoxyethyl)propanediamide |
| SMILES | COCCNC(=O)CC(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C12H15FN2O3/c1-18-6-5-14-11(16)8-12(17)15-10-4-2-3-9(13)7-10/h2-4,7H,5-6,8H2,1H3,(H,14,16)(H,15,17) |
| InChIKey | XHBAHIGETOXPEL-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|