C17H19N3O6S — CID 2248452
butyl N-[4-[(3-nitrophenyl)sulfamoyl]phenyl]carbamate (PubChem CID 2248452) has the molecular formula C17H19N3O6S and a molecular weight of 393.42 g/mol. Its IUPAC name is butyl N-[4-[(3-nitrophenyl)sulfamoyl]phenyl]carbamate.
| Compound Name | butyl N-[4-[(3-nitrophenyl)sulfamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 2248452 |
| Molecular Formula | C17H19N3O6S |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | butyl N-[4-[(3-nitrophenyl)sulfamoyl]phenyl]carbamate |
| SMILES | CCCCOC(=O)Nc1ccc(S(=O)(=O)Nc2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C17H19N3O6S/c1-2-3-11-26-17(21)18-13-7-9-16(10-8-13)27(24,25)19-14-5-4-6-15(12-14)20(22)23/h4-10,12,19H,2-3,11H2,1H3,(H,18,21) |
| InChIKey | LIASEEWTVOAEPZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|