C28H36N4O6S — CID 153299590
benzyl N-[(2S)-1-[4-(benzenesulfonylmethyl)piperazin-1-yl]-1-oxo-6-(prop-2-enoylamino)hexan-2-yl]carbamate (PubChem CID 153299590) has the molecular formula C28H36N4O6S and a molecular weight of 556.69 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[4-(benzenesulfonylmethyl)piperazin-1-yl]-1-oxo-6-(prop-2-enoylamino)hexan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[4-(benzenesulfonylmethyl)piperazin-1-yl]-1-oxo-6-(prop-2-enoylamino)hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 153299590 |
| Molecular Formula | C28H36N4O6S |
| Molecular Weight | 556.69 g/mol |
| Exact Mass | 556.24 |
| IUPAC Name | benzyl N-[(2S)-1-[4-(benzenesulfonylmethyl)piperazin-1-yl]-1-oxo-6-(prop-2-enoylamino)hexan-2-yl]carbamate |
| SMILES | C=CC(=O)NCCCC[C@H](NC(=O)OCc1ccccc1)C(=O)N1CCN(CS(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C28H36N4O6S/c1-2-26(33)29-16-10-9-15-25(30-28(35)38-21-23-11-5-3-6-12-23)27(34)32-19-17-31(18-20-32)22-39(36,37)24-13-7-4-8-14-24/h2-8,11-14,25H,1,9-10,15-22H2,(H,29,33)(H,30,35)/t25-/m0/s1 |
| InChIKey | QJWXJLMJTQVOKO-VWLOTQADSA-N |
| XLogP | 2.33 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.69 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|