C33H37N3O5 — CID 159802119
benzyl (3R)-3-[4-(naphthalene-2-carbonyl)piperazine-1-carbonyl]-7-(prop-2-enoylamino)heptanoate (PubChem CID 159802119) has the molecular formula C33H37N3O5 and a molecular weight of 555.68 g/mol. Its IUPAC name is benzyl (3R)-3-[4-(naphthalene-2-carbonyl)piperazine-1-carbonyl]-7-(prop-2-enoylamino)heptanoate.
| Compound Name | benzyl (3R)-3-[4-(naphthalene-2-carbonyl)piperazine-1-carbonyl]-7-(prop-2-enoylamino)heptanoate |
|---|---|
| PubChem CID | 159802119 |
| Molecular Formula | C33H37N3O5 |
| Molecular Weight | 555.68 g/mol |
| Exact Mass | 555.27 |
| IUPAC Name | benzyl (3R)-3-[4-(naphthalene-2-carbonyl)piperazine-1-carbonyl]-7-(prop-2-enoylamino)heptanoate |
| SMILES | C=CC(=O)NCCCCC(CC(=O)OCc1ccccc1)C(=O)N1CCN(C(=O)c2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C33H37N3O5/c1-2-30(37)34-17-9-8-14-28(23-31(38)41-24-25-10-4-3-5-11-25)32(39)35-18-20-36(21-19-35)33(40)29-16-15-26-12-6-7-13-27(26)22-29/h2-7,10-13,15-16,22,28H,1,8-9,14,17-21,23-24H2,(H,34,37) |
| InChIKey | YHZUDWRYKUORDJ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.68 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|