C30H35N5O3 — CID 71459379
N-[(2S)-1-[4-(6-methyl-2-pyridinyl)piperazin-1-yl]-1-oxo-6-(prop-2-enoylamino)hexan-2-yl]naphthalene-2-carboxamide (PubChem CID 71459379) has the molecular formula C30H35N5O3 and a molecular weight of 513.64 g/mol. Its IUPAC name is N-[(2S)-1-[4-(6-methyl-2-pyridinyl)piperazin-1-yl]-1-oxo-6-(prop-2-enoylamino)hexan-2-yl]naphthalene-2-carboxamide.
| Compound Name | N-[(2S)-1-[4-(6-methyl-2-pyridinyl)piperazin-1-yl]-1-oxo-6-(prop-2-enoylamino)hexan-2-yl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 71459379 |
| Molecular Formula | C30H35N5O3 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.27 |
| IUPAC Name | N-[(2S)-1-[4-(6-methyl-2-pyridinyl)piperazin-1-yl]-1-oxo-6-(prop-2-enoylamino)hexan-2-yl]naphthalene-2-carboxamide |
| SMILES | C=CC(=O)NCCCC[C@H](NC(=O)c1ccc2ccccc2c1)C(=O)N1CCN(c2cccc(C)n2)CC1 |
| InChI | InChI=1S/C30H35N5O3/c1-3-28(36)31-16-7-6-12-26(33-29(37)25-15-14-23-10-4-5-11-24(23)21-25)30(38)35-19-17-34(18-20-35)27-13-8-9-22(2)32-27/h3-5,8-11,13-15,21,26H,1,6-7,12,16-20H2,2H3,(H,31,36)(H,33,37)/t26-/m0/s1 |
| InChIKey | LGNAHQIURFVUDM-SANMLTNESA-N |
| XLogP | 3.46 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|