C36H43N5O5 — CID 171348018
N-[(2S)-1-[4-[(2S)-2-[[2-(2-methylphenyl)acetyl]amino]-6-(prop-2-enoylamino)hexanoyl]piperazin-1-yl]-1-oxopropan-2-yl]naphthalene-1-carboxamide (PubChem CID 171348018) has the molecular formula C36H43N5O5 and a molecular weight of 625.77 g/mol. Its IUPAC name is N-[(2S)-1-[4-[(2S)-2-[[2-(2-methylphenyl)acetyl]amino]-6-(prop-2-enoylamino)hexanoyl]piperazin-1-yl]-1-oxopropan-2-yl]naphthalene-1-carboxamide.
| Compound Name | N-[(2S)-1-[4-[(2S)-2-[[2-(2-methylphenyl)acetyl]amino]-6-(prop-2-enoylamino)hexanoyl]piperazin-1-yl]-1-oxopropan-2-yl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 171348018 |
| Molecular Formula | C36H43N5O5 |
| Molecular Weight | 625.77 g/mol |
| Exact Mass | 625.33 |
| IUPAC Name | N-[(2S)-1-[4-[(2S)-2-[[2-(2-methylphenyl)acetyl]amino]-6-(prop-2-enoylamino)hexanoyl]piperazin-1-yl]-1-oxopropan-2-yl]naphthalene-1-carboxamide |
| SMILES | C=CC(=O)NCCCC[C@H](NC(=O)Cc1ccccc1C)C(=O)N1CCN(C(=O)[C@H](C)NC(=O)c2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C36H43N5O5/c1-4-32(42)37-19-10-9-18-31(39-33(43)24-28-14-6-5-12-25(28)2)36(46)41-22-20-40(21-23-41)35(45)26(3)38-34(44)30-17-11-15-27-13-7-8-16-29(27)30/h4-8,11-17,26,31H,1,9-10,18-24H2,2-3H3,(H,37,42)(H,38,44)(H,39,43)/t26-,31-/m0/s1 |
| InChIKey | ZOEKUVGKOXRGLK-HVNZXBJASA-N |
| XLogP | 3.14 |
| TPSA | 127.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.77 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|