C33H38N4O4 — CID 165400408
N-[(5S)-5-[[2-(2-methylphenyl)acetyl]amino]-6-[4-(naphthalene-1-carbonyl)piperazin-1-yl]-6-oxohexyl]prop-2-enamide (PubChem CID 165400408) has the molecular formula C33H38N4O4 and a molecular weight of 554.69 g/mol. Its IUPAC name is N-[(5S)-5-[[2-(2-methylphenyl)acetyl]amino]-6-[4-(naphthalene-1-carbonyl)piperazin-1-yl]-6-oxohexyl]prop-2-enamide.
| Compound Name | N-[(5S)-5-[[2-(2-methylphenyl)acetyl]amino]-6-[4-(naphthalene-1-carbonyl)piperazin-1-yl]-6-oxohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 165400408 |
| Molecular Formula | C33H38N4O4 |
| Molecular Weight | 554.69 g/mol |
| Exact Mass | 554.29 |
| IUPAC Name | N-[(5S)-5-[[2-(2-methylphenyl)acetyl]amino]-6-[4-(naphthalene-1-carbonyl)piperazin-1-yl]-6-oxohexyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCCC[C@H](NC(=O)Cc1ccccc1C)C(=O)N1CCN(C(=O)c2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C33H38N4O4/c1-3-30(38)34-18-9-8-17-29(35-31(39)23-26-13-5-4-11-24(26)2)33(41)37-21-19-36(20-22-37)32(40)28-16-10-14-25-12-6-7-15-27(25)28/h3-7,10-16,29H,1,8-9,17-23H2,2H3,(H,34,38)(H,35,39)/t29-/m0/s1 |
| InChIKey | QJLVBJOGNOFVAV-LJAQVGFWSA-N |
| XLogP | 3.63 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.69 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|