C26H33N5O3 — CID 90080259
N-[(5S)-5-(N-formylanilino)-6-[4-(6-methyl-2-pyridinyl)piperazin-1-yl]-6-oxohexyl]prop-2-enamide (PubChem CID 90080259) has the molecular formula C26H33N5O3 and a molecular weight of 463.58 g/mol. Its IUPAC name is N-[(5S)-5-(N-formylanilino)-6-[4-(6-methyl-2-pyridinyl)piperazin-1-yl]-6-oxohexyl]prop-2-enamide.
| Compound Name | N-[(5S)-5-(N-formylanilino)-6-[4-(6-methyl-2-pyridinyl)piperazin-1-yl]-6-oxohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 90080259 |
| Molecular Formula | C26H33N5O3 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.26 |
| IUPAC Name | N-[(5S)-5-(N-formylanilino)-6-[4-(6-methyl-2-pyridinyl)piperazin-1-yl]-6-oxohexyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCCC[C@@H](C(=O)N1CCN(c2cccc(C)n2)CC1)N(C=O)c1ccccc1 |
| InChI | InChI=1S/C26H33N5O3/c1-3-25(33)27-15-8-7-13-23(31(20-32)22-11-5-4-6-12-22)26(34)30-18-16-29(17-19-30)24-14-9-10-21(2)28-24/h3-6,9-12,14,20,23H,1,7-8,13,15-19H2,2H3,(H,27,33)/t23-/m0/s1 |
| InChIKey | NRYJIXUMIYAGQY-QHCPKHFHSA-N |
| XLogP | 2.54 |
| TPSA | 85.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|