C20H29N3O4 — CID 90876674
benzyl 4-[[(4S)-4-amino-5-oxo-5-pyrrolidin-1-ylpentanoyl]amino]butanoate (PubChem CID 90876674) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is benzyl 4-[[(4S)-4-amino-5-oxo-5-pyrrolidin-1-ylpentanoyl]amino]butanoate.
| Compound Name | benzyl 4-[[(4S)-4-amino-5-oxo-5-pyrrolidin-1-ylpentanoyl]amino]butanoate |
|---|---|
| PubChem CID | 90876674 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | benzyl 4-[[(4S)-4-amino-5-oxo-5-pyrrolidin-1-ylpentanoyl]amino]butanoate |
| SMILES | N[C@@H](CCC(=O)NCCCC(=O)OCc1ccccc1)C(=O)N1CCCC1 |
| InChI | InChI=1S/C20H29N3O4/c21-17(20(26)23-13-4-5-14-23)10-11-18(24)22-12-6-9-19(25)27-15-16-7-2-1-3-8-16/h1-3,7-8,17H,4-6,9-15,21H2,(H,22,24)/t17-/m0/s1 |
| InChIKey | HFWHTIUTKURONH-KRWDZBQOSA-N |
| XLogP | 1.36 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|