C14H19N3O4 — CID 11975613
benzyl (2S)-2-amino-5-[(2-amino-2-oxoethyl)amino]-5-oxopentanoate (PubChem CID 11975613) has the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. Its IUPAC name is benzyl (2S)-2-amino-5-[(2-amino-2-oxoethyl)amino]-5-oxopentanoate.
| Compound Name | benzyl (2S)-2-amino-5-[(2-amino-2-oxoethyl)amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 11975613 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | benzyl (2S)-2-amino-5-[(2-amino-2-oxoethyl)amino]-5-oxopentanoate |
| SMILES | NC(=O)CNC(=O)CC[C@H](N)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H19N3O4/c15-11(6-7-13(19)17-8-12(16)18)14(20)21-9-10-4-2-1-3-5-10/h1-5,11H,6-9,15H2,(H2,16,18)(H,17,19)/t11-/m0/s1 |
| InChIKey | AJPYPBSOAVVGCC-NSHDSACASA-N |
| XLogP | -0.56 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |