C13H18N2O5S — CID 54570824
benzyl (2S)-2-amino-5-(methanesulfonamido)-5-oxopentanoate (PubChem CID 54570824) has the molecular formula C13H18N2O5S and a molecular weight of 314.36 g/mol. Its IUPAC name is benzyl (2S)-2-amino-5-(methanesulfonamido)-5-oxopentanoate.
| Compound Name | benzyl (2S)-2-amino-5-(methanesulfonamido)-5-oxopentanoate |
|---|---|
| PubChem CID | 54570824 |
| Molecular Formula | C13H18N2O5S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | benzyl (2S)-2-amino-5-(methanesulfonamido)-5-oxopentanoate |
| SMILES | CS(=O)(=O)NC(=O)CC[C@H](N)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H18N2O5S/c1-21(18,19)15-12(16)8-7-11(14)13(17)20-9-10-5-3-2-4-6-10/h2-6,11H,7-9,14H2,1H3,(H,15,16)/t11-/m0/s1 |
| InChIKey | ZXDBLARIGWIRTL-NSHDSACASA-N |
| XLogP | -0.09 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |