C22H31NO5 — CID 160592192
(2R)-2-[2-[(4-tert-butylphenyl)methoxy]-2-oxoethyl]-6-(prop-2-enoylamino)hexanoic acid (PubChem CID 160592192) has the molecular formula C22H31NO5 and a molecular weight of 389.49 g/mol. Its IUPAC name is (2R)-2-[2-[(4-tert-butylphenyl)methoxy]-2-oxoethyl]-6-(prop-2-enoylamino)hexanoic acid.
| Compound Name | (2R)-2-[2-[(4-tert-butylphenyl)methoxy]-2-oxoethyl]-6-(prop-2-enoylamino)hexanoic acid |
|---|---|
| PubChem CID | 160592192 |
| Molecular Formula | C22H31NO5 |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | (2R)-2-[2-[(4-tert-butylphenyl)methoxy]-2-oxoethyl]-6-(prop-2-enoylamino)hexanoic acid |
| SMILES | C=CC(=O)NCCCC[C@H](CC(=O)OCc1ccc(C(C)(C)C)cc1)C(=O)O |
| InChI | InChI=1S/C22H31NO5/c1-5-19(24)23-13-7-6-8-17(21(26)27)14-20(25)28-15-16-9-11-18(12-10-16)22(2,3)4/h5,9-12,17H,1,6-8,13-15H2,2-4H3,(H,23,24)(H,26,27)/t17-/m1/s1 |
| InChIKey | RDEFKLJXHGNMDM-QGZVFWFLSA-N |
| XLogP | 3.59 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|