C30H47N3O8 — CID 90826148
tert-butyl 2-[1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(phenylmethoxycarbonylamino)hexanoyl]pyrrolidin-2-yl]ethyl carbonate (PubChem CID 90826148) has the molecular formula C30H47N3O8 and a molecular weight of 577.72 g/mol. Its IUPAC name is tert-butyl 2-[1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(phenylmethoxycarbonylamino)hexanoyl]pyrrolidin-2-yl]ethyl carbonate.
| Compound Name | tert-butyl 2-[1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(phenylmethoxycarbonylamino)hexanoyl]pyrrolidin-2-yl]ethyl carbonate |
|---|---|
| PubChem CID | 90826148 |
| Molecular Formula | C30H47N3O8 |
| Molecular Weight | 577.72 g/mol |
| Exact Mass | 577.34 |
| IUPAC Name | tert-butyl 2-[1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(phenylmethoxycarbonylamino)hexanoyl]pyrrolidin-2-yl]ethyl carbonate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCCNC(=O)OCc1ccccc1)C(=O)N1CCCC1CCOC(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H47N3O8/c1-29(2,3)40-27(36)32-24(16-10-11-18-31-26(35)39-21-22-13-8-7-9-14-22)25(34)33-19-12-15-23(33)17-20-38-28(37)41-30(4,5)6/h7-9,13-14,23-24H,10-12,15-21H2,1-6H3,(H,31,35)(H,32,36)/t23?,24-/m0/s1 |
| InChIKey | SNKOTBZHNWEQCO-CGAIIQECSA-N |
| XLogP | 5.31 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.72 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|