C23H34N4O7 — CID 11113569
benzyl N-[(4S)-5-[[(3S)-1-hydroxy-2-oxopiperidin-3-yl]amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentyl]carbamate (PubChem CID 11113569) has the molecular formula C23H34N4O7 and a molecular weight of 478.55 g/mol. Its IUPAC name is benzyl N-[(4S)-5-[[(3S)-1-hydroxy-2-oxopiperidin-3-yl]amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentyl]carbamate.
| Compound Name | benzyl N-[(4S)-5-[[(3S)-1-hydroxy-2-oxopiperidin-3-yl]amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentyl]carbamate |
|---|---|
| PubChem CID | 11113569 |
| Molecular Formula | C23H34N4O7 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | benzyl N-[(4S)-5-[[(3S)-1-hydroxy-2-oxopiperidin-3-yl]amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCNC(=O)OCc1ccccc1)C(=O)N[C@H]1CCCN(O)C1=O |
| InChI | InChI=1S/C23H34N4O7/c1-23(2,3)34-22(31)26-17(19(28)25-18-12-8-14-27(32)20(18)29)11-7-13-24-21(30)33-15-16-9-5-4-6-10-16/h4-6,9-10,17-18,32H,7-8,11-15H2,1-3H3,(H,24,30)(H,25,28)(H,26,31)/t17-,18-/m0/s1 |
| InChIKey | PVJBYLKOCSJECW-ROUUACIJSA-N |
| XLogP | 2.08 |
| TPSA | 146.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|