C23H29N3O3 — CID 54508286
benzyl N-[(2S)-6-amino-1-(2,3-dihydro-1H-inden-2-ylamino)-1-oxohexan-2-yl]carbamate (PubChem CID 54508286) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is benzyl N-[(2S)-6-amino-1-(2,3-dihydro-1H-inden-2-ylamino)-1-oxohexan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-6-amino-1-(2,3-dihydro-1H-inden-2-ylamino)-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 54508286 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | benzyl N-[(2S)-6-amino-1-(2,3-dihydro-1H-inden-2-ylamino)-1-oxohexan-2-yl]carbamate |
| SMILES | NCCCC[C@H](NC(=O)OCc1ccccc1)C(=O)NC1Cc2ccccc2C1 |
| InChI | InChI=1S/C23H29N3O3/c24-13-7-6-12-21(26-23(28)29-16-17-8-2-1-3-9-17)22(27)25-20-14-18-10-4-5-11-19(18)15-20/h1-5,8-11,20-21H,6-7,12-16,24H2,(H,25,27)(H,26,28)/t21-/m0/s1 |
| InChIKey | YHGWLVGCDQQVSD-NRFANRHFSA-N |
| XLogP | 2.69 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|