C21H32N6O2S — CID 55718713
1-N,1-N-diethyl-4-N-[3-methylsulfanyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]piperidine-1,4-dicarboxamide (PubChem CID 55718713) has the molecular formula C21H32N6O2S and a molecular weight of 432.59 g/mol. Its IUPAC name is 1-N,1-N-diethyl-4-N-[3-methylsulfanyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]piperidine-1,4-dicarboxamide.
| Compound Name | 1-N,1-N-diethyl-4-N-[3-methylsulfanyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 55718713 |
| Molecular Formula | C21H32N6O2S |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 1-N,1-N-diethyl-4-N-[3-methylsulfanyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]piperidine-1,4-dicarboxamide |
| SMILES | CCN(CC)C(=O)N1CCC(C(=O)NC(CCSC)c2nnc3ccccn23)CC1 |
| InChI | InChI=1S/C21H32N6O2S/c1-4-25(5-2)21(29)26-13-9-16(10-14-26)20(28)22-17(11-15-30-3)19-24-23-18-8-6-7-12-27(18)19/h6-8,12,16-17H,4-5,9-11,13-15H2,1-3H3,(H,22,28) |
| InChIKey | GIEBSKUSJACJJT-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 82.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |